C27H34N2O5 — CID 17137720
(E)-2-acetamido-N-[4-(2-cyclohexylethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 17137720) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is (E)-2-acetamido-N-[4-(2-cyclohexylethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-acetamido-N-[4-(2-cyclohexylethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17137720 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (E)-2-acetamido-N-[4-(2-cyclohexylethoxy)phenyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C(/NC(C)=O)C(=O)Nc2ccc(OCCC3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C27H34N2O5/c1-19(30)28-24(17-21-9-14-25(32-2)26(18-21)33-3)27(31)29-22-10-12-23(13-11-22)34-16-15-20-7-5-4-6-8-20/h9-14,17-18,20H,4-8,15-16H2,1-3H3,(H,28,30)(H,29,31)/b24-17+ |
| InChIKey | VRRYCCHKDLMBIC-JJIBRWJFSA-N |
| XLogP | 5.17 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|