C21H40Na2O7P+ — CID 171377349
disodium;2,3-dihydroxypropyl (E)-octadec-9-enoate;dioxido(oxo)phosphanium (PubChem CID 171377349) has the molecular formula C21H40Na2O7P+ and a molecular weight of 481.50 g/mol. Its IUPAC name is disodium;2,3-dihydroxypropyl (E)-octadec-9-enoate;dioxido(oxo)phosphanium.
| Compound Name | disodium;2,3-dihydroxypropyl (E)-octadec-9-enoate;dioxido(oxo)phosphanium |
|---|---|
| PubChem CID | 171377349 |
| Molecular Formula | C21H40Na2O7P+ |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | disodium;2,3-dihydroxypropyl (E)-octadec-9-enoate;dioxido(oxo)phosphanium |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(O)CO.O=[P+]([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H40O4.2Na.HO3P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;;;1-4(2)3/h9-10,20,22-23H,2-8,11-19H2,1H3;;;(H,1,2,3)/q;2*+1;/p-1/b10-9+;;; |
| InChIKey | IWKSRYMZIVKGAQ-WCVSPGPUSA-M |
| XLogP | -2.71 |
| TPSA | 129.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|