C13H10ClNO3 — CID 171379336
3-(3-amino-5-chloro-2-hydroxyphenyl)-2,4,5,6-tetradeuteriobenzoic acid (PubChem CID 171379336) has the molecular formula C13H10ClNO3 and a molecular weight of 267.70 g/mol. Its IUPAC name is 3-(3-amino-5-chloro-2-hydroxyphenyl)-2,4,5,6-tetradeuteriobenzoic acid.
| Compound Name | 3-(3-amino-5-chloro-2-hydroxyphenyl)-2,4,5,6-tetradeuteriobenzoic acid |
|---|---|
| PubChem CID | 171379336 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-(3-amino-5-chloro-2-hydroxyphenyl)-2,4,5,6-tetradeuteriobenzoic acid |
| SMILES | [2H]c1c([2H])c(C(=O)O)c([2H])c(-c2cc(Cl)cc(N)c2O)c1[2H] |
| InChI | InChI=1S/C13H10ClNO3/c14-9-5-10(12(16)11(15)6-9)7-2-1-3-8(4-7)13(17)18/h1-6,16H,15H2,(H,17,18)/i1D,2D,3D,4D |
| InChIKey | SKJKBAMFFKMQJF-RHQRLBAQSA-N |
| XLogP | 2.99 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|