C24H27FN2O5 — CID 171381584
1-[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-oxidopiperidin-1-ium-1-yl]propoxy]-3-(trideuteriomethoxy)phenyl]ethanone (PubChem CID 171381584) has the molecular formula C24H27FN2O5 and a molecular weight of 445.51 g/mol. Its IUPAC name is 1-[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-oxidopiperidin-1-ium-1-yl]propoxy]-3-(trideuteriomethoxy)phenyl]ethanone.
| Compound Name | 1-[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-oxidopiperidin-1-ium-1-yl]propoxy]-3-(trideuteriomethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 171381584 |
| Molecular Formula | C24H27FN2O5 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 1-[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-oxidopiperidin-1-ium-1-yl]propoxy]-3-(trideuteriomethoxy)phenyl]ethanone |
| SMILES | [2H]C([2H])([2H])Oc1cc(C(C)=O)ccc1OCCC[N+]1([O-])CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C24H27FN2O5/c1-16(28)18-4-7-21(23(14-18)30-2)31-13-3-10-27(29)11-8-17(9-12-27)24-20-6-5-19(25)15-22(20)32-26-24/h4-7,14-15,17H,3,8-13H2,1-2H3/i2D3 |
| InChIKey | ILSADFMLVIKNNS-BMSJAHLVSA-N |
| XLogP | 4.84 |
| TPSA | 84.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|