C23H27FN3O4+ — CID 23373005
4-[3-[1-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-ium-1-yl]propoxy]-3-methoxybenzamide (PubChem CID 23373005) has the molecular formula C23H27FN3O4+ and a molecular weight of 428.48 g/mol. Its IUPAC name is 4-[3-[1-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-ium-1-yl]propoxy]-3-methoxybenzamide.
| Compound Name | 4-[3-[1-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-ium-1-yl]propoxy]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23373005 |
| Molecular Formula | C23H27FN3O4+ |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-[3-[1-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-ium-1-yl]propoxy]-3-methoxybenzamide |
| SMILES | COc1cc(C(N)=O)ccc1OCCC[N+]1(c2noc3cc(F)ccc23)CCCCC1 |
| InChI | InChI=1S/C23H26FN3O4/c1-29-21-14-16(22(25)28)6-9-19(21)30-13-5-12-27(10-3-2-4-11-27)23-18-8-7-17(24)15-20(18)31-26-23/h6-9,14-15H,2-5,10-13H2,1H3,(H-,25,28)/p+1 |
| InChIKey | KICJTZPTJRVTCD-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|