C15H9F5O4 — CID 171382794
3-(difluoromethoxy)-5-[2-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 171382794) has the molecular formula C15H9F5O4 and a molecular weight of 348.22 g/mol. Its IUPAC name is 3-(difluoromethoxy)-5-[2-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 3-(difluoromethoxy)-5-[2-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 171382794 |
| Molecular Formula | C15H9F5O4 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-(difluoromethoxy)-5-[2-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | O=C(O)c1cc(OC(F)F)cc(-c2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H9F5O4/c16-14(17)23-10-6-8(5-9(7-10)13(21)22)11-3-1-2-4-12(11)24-15(18,19)20/h1-7,14H,(H,21,22) |
| InChIKey | AZZRUZUJINTJOE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |