5-methylhexan-2-yl quinoxaline-6-carboxylate

C16H20N2O2 — CID 171383157

IUPAC5-methylhexan-2-yl quinoxaline-6-carboxylate
SMILESCC(C)CCC(C)OC(=O)c1ccc2nccnc2c1
InChIInChI=1S/C16H20N2O2/c1-11(2)4-5-12(3)20-16(19)13-6-7-14-15(10-13)18-9-8-17-14/h6-12H,4-5H2,1-3H3
InChIKeyORXUEDRMJZDQNW-UHFFFAOYSA-N
MW272.35 g/mol
LogP3.61
Rot. Bonds5

About 5-methylhexan-2-yl quinoxaline-6-carboxylate

5-methylhexan-2-yl quinoxaline-6-carboxylate (PubChem CID 171383157) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-methylhexan-2-yl quinoxaline-6-carboxylate.

Molecular Properties

Compound Name5-methylhexan-2-yl quinoxaline-6-carboxylate
PubChem CID171383157
Molecular FormulaC16H20N2O2
Molecular Weight272.35 g/mol
Exact Mass272.15
IUPAC Name5-methylhexan-2-yl quinoxaline-6-carboxylate
SMILESCC(C)CCC(C)OC(=O)c1ccc2nccnc2c1
InChIInChI=1S/C16H20N2O2/c1-11(2)4-5-12(3)20-16(19)13-6-7-14-15(10-13)18-9-8-17-14/h6-12H,4-5H2,1-3H3
InChIKeyORXUEDRMJZDQNW-UHFFFAOYSA-N
XLogP3.61
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500272.35
LogP ≤ 53.61
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 5-methylhexan-2-yl quinoxaline-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The IUPAC name of 5-methylhexan-2-yl quinoxaline-6-carboxylate (CID 171383157) is 5-methylhexan-2-yl quinoxaline-6-carboxylate.
What is the SMILES notation for 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The canonical SMILES for 5-methylhexan-2-yl quinoxaline-6-carboxylate is CC(C)CCC(C)OC(=O)c1ccc2nccnc2c1.
What is the InChIKey of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The InChIKey is ORXUEDRMJZDQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-11(2)4-5-12(3)20-16(19)13-6-7-14-15(10-13)18-9-8-17-14/h6-12H,4-5H2,1-3H3.
What are the key properties of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
5-methylhexan-2-yl quinoxaline-6-carboxylate has a molecular weight of 272.35 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexan-2-yl quinoxaline-6-carboxylate is sourced from PubChem (CID 171383157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).