About 5-methylhexan-2-yl quinoxaline-6-carboxylate
5-methylhexan-2-yl quinoxaline-6-carboxylate (PubChem CID 171383157) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-methylhexan-2-yl quinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | 5-methylhexan-2-yl quinoxaline-6-carboxylate |
| PubChem CID | 171383157 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-methylhexan-2-yl quinoxaline-6-carboxylate |
| SMILES | CC(C)CCC(C)OC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C16H20N2O2/c1-11(2)4-5-12(3)20-16(19)13-6-7-14-15(10-13)18-9-8-17-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | ORXUEDRMJZDQNW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylhexan-2-yl quinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The IUPAC name of 5-methylhexan-2-yl quinoxaline-6-carboxylate (CID 171383157) is 5-methylhexan-2-yl quinoxaline-6-carboxylate.
What is the SMILES notation for 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The canonical SMILES for 5-methylhexan-2-yl quinoxaline-6-carboxylate is CC(C)CCC(C)OC(=O)c1ccc2nccnc2c1.
What is the InChIKey of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
The InChIKey is ORXUEDRMJZDQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-11(2)4-5-12(3)20-16(19)13-6-7-14-15(10-13)18-9-8-17-14/h6-12H,4-5H2,1-3H3.
What are the key properties of 5-methylhexan-2-yl quinoxaline-6-carboxylate?
5-methylhexan-2-yl quinoxaline-6-carboxylate has a molecular weight of 272.35 g/mol, XLogP of 3.61, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexan-2-yl quinoxaline-6-carboxylate is sourced from PubChem (CID 171383157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).