C6H9N3 — CID 171383916
1,6-dimethylpyrimidin-2-imine (PubChem CID 171383916) has the molecular formula C6H9N3 and a molecular weight of 123.16 g/mol. Its IUPAC name is 1,6-dimethylpyrimidin-2-imine.
| Compound Name | 1,6-dimethylpyrimidin-2-imine |
|---|---|
| PubChem CID | 171383916 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 1,6-dimethylpyrimidin-2-imine |
| SMILES | [H]/N=c1\nccc(C)n1C |
| InChI | InChI=1S/C6H9N3/c1-5-3-4-8-6(7)9(5)2/h3-4,7H,1-2H3/b7-6+ |
| InChIKey | HLBGKDIKRBSUJQ-VOTSOKGWSA-N |
| XLogP | 0.21 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |