C9H13N3 — CID 142889505
acetylene;N,1,6-trimethylpyrimidin-2-imine (PubChem CID 142889505) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is acetylene;N,1,6-trimethylpyrimidin-2-imine.
| Compound Name | acetylene;N,1,6-trimethylpyrimidin-2-imine |
|---|---|
| PubChem CID | 142889505 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | acetylene;N,1,6-trimethylpyrimidin-2-imine |
| SMILES | C#C.C/N=c1\nccc(C)n1C |
| InChI | InChI=1S/C7H11N3.C2H2/c1-6-4-5-9-7(8-2)10(6)3;1-2/h4-5H,1-3H3;1-2H/b8-7+; |
| InChIKey | CACLJYPRROGAPQ-USRGLUTNSA-N |
| XLogP | 0.51 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|