C11H19N5O — CID 171384073
2-amino-3,5,6,7,7-pentamethyl-6,8-dihydropteridin-4-one (PubChem CID 171384073) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-amino-3,5,6,7,7-pentamethyl-6,8-dihydropteridin-4-one.
| Compound Name | 2-amino-3,5,6,7,7-pentamethyl-6,8-dihydropteridin-4-one |
|---|---|
| PubChem CID | 171384073 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-amino-3,5,6,7,7-pentamethyl-6,8-dihydropteridin-4-one |
| SMILES | CC1N(C)c2c(nc(N)n(C)c2=O)NC1(C)C |
| InChI | InChI=1S/C11H19N5O/c1-6-11(2,3)14-8-7(15(6)4)9(17)16(5)10(12)13-8/h6,14H,1-5H3,(H2,12,13) |
| InChIKey | SUSISQLRJLQJLM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |