C10H17N5O4 — CID 171384398
ethyl N-[5-[(ethoxycarbonylamino)methyl]-1-methyltriazol-4-yl]carbamate (PubChem CID 171384398) has the molecular formula C10H17N5O4 and a molecular weight of 271.28 g/mol. Its IUPAC name is ethyl N-[5-[(ethoxycarbonylamino)methyl]-1-methyltriazol-4-yl]carbamate.
| Compound Name | ethyl N-[5-[(ethoxycarbonylamino)methyl]-1-methyltriazol-4-yl]carbamate |
|---|---|
| PubChem CID | 171384398 |
| Molecular Formula | C10H17N5O4 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | ethyl N-[5-[(ethoxycarbonylamino)methyl]-1-methyltriazol-4-yl]carbamate |
| SMILES | CCOC(=O)NCc1c(NC(=O)OCC)nnn1C |
| InChI | InChI=1S/C10H17N5O4/c1-4-18-9(16)11-6-7-8(13-14-15(7)3)12-10(17)19-5-2/h4-6H2,1-3H3,(H,11,16)(H,12,17) |
| InChIKey | DQINSKFGWQQYCC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |