C18H19N3 — CID 171385206
4,6,8-trimethyl-2-(1-prop-2-enylpyrazol-4-yl)quinoline (PubChem CID 171385206) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4,6,8-trimethyl-2-(1-prop-2-enylpyrazol-4-yl)quinoline.
| Compound Name | 4,6,8-trimethyl-2-(1-prop-2-enylpyrazol-4-yl)quinoline |
|---|---|
| PubChem CID | 171385206 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 4,6,8-trimethyl-2-(1-prop-2-enylpyrazol-4-yl)quinoline |
| SMILES | C=CCn1cc(-c2cc(C)c3cc(C)cc(C)c3n2)cn1 |
| InChI | InChI=1S/C18H19N3/c1-5-6-21-11-15(10-19-21)17-9-13(3)16-8-12(2)7-14(4)18(16)20-17/h5,7-11H,1,6H2,2-4H3 |
| InChIKey | OXGUAYOPNDZVQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|