C13H16N2 — CID 82573618
(4,6,8-trimethylquinolin-2-yl)methanamine (PubChem CID 82573618) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (4,6,8-trimethylquinolin-2-yl)methanamine.
| Compound Name | (4,6,8-trimethylquinolin-2-yl)methanamine |
|---|---|
| PubChem CID | 82573618 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (4,6,8-trimethylquinolin-2-yl)methanamine |
| SMILES | Cc1cc(C)c2nc(CN)cc(C)c2c1 |
| InChI | InChI=1S/C13H16N2/c1-8-4-10(3)13-12(5-8)9(2)6-11(7-14)15-13/h4-6H,7,14H2,1-3H3 |
| InChIKey | KMOYPYUDNPMWEJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |