C18H11CuN6NaO8S — CID 171391214
copper;sodium;3-[[3-[(3-amino-4-nitrophenyl)diazenyl]-4-hydroxy-2-oxidophenyl]diazenyl]-4-oxidobenzenesulfonate (PubChem CID 171391214) has the molecular formula C18H11CuN6NaO8S and a molecular weight of 557.92 g/mol. Its IUPAC name is copper;sodium;3-[[3-[(3-amino-4-nitrophenyl)diazenyl]-4-hydroxy-2-oxidophenyl]diazenyl]-4-oxidobenzenesulfonate.
| Compound Name | copper;sodium;3-[[3-[(3-amino-4-nitrophenyl)diazenyl]-4-hydroxy-2-oxidophenyl]diazenyl]-4-oxidobenzenesulfonate |
|---|---|
| PubChem CID | 171391214 |
| Molecular Formula | C18H11CuN6NaO8S |
| Molecular Weight | 557.92 g/mol |
| Exact Mass | 556.96 |
| IUPAC Name | copper;sodium;3-[[3-[(3-amino-4-nitrophenyl)diazenyl]-4-hydroxy-2-oxidophenyl]diazenyl]-4-oxidobenzenesulfonate |
| SMILES | Nc1cc(/N=N/c2c(O)ccc(/N=N/c3cc(S(=O)(=O)[O-])ccc3[O-])c2[O-])ccc1[N+](=O)[O-].[Cu+2].[Na+] |
| InChI | InChI=1S/C18H14N6O8S.Cu.Na/c19-11-7-9(1-4-14(11)24(28)29)20-23-17-16(26)6-3-12(18(17)27)21-22-13-8-10(33(30,31)32)2-5-15(13)25;;/h1-8,25-27H,19H2,(H,30,31,32);;/q;+2;+1/p-3/b22-21+,23-20+;; |
| InChIKey | GBLJDBLIDIXEQL-XGOFKLCLSA-K |
| XLogP | -0.23 |
| TPSA | 242.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.92 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|