C13H13N5O6S — CID 147913674
4-hydroxy-3-[[4-hydroxy-3-(methylamino)phenyl]diazenyl]-5-nitrobenzenesulfonamide (PubChem CID 147913674) has the molecular formula C13H13N5O6S and a molecular weight of 367.34 g/mol. Its IUPAC name is 4-hydroxy-3-[[4-hydroxy-3-(methylamino)phenyl]diazenyl]-5-nitrobenzenesulfonamide.
| Compound Name | 4-hydroxy-3-[[4-hydroxy-3-(methylamino)phenyl]diazenyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 147913674 |
| Molecular Formula | C13H13N5O6S |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 4-hydroxy-3-[[4-hydroxy-3-(methylamino)phenyl]diazenyl]-5-nitrobenzenesulfonamide |
| SMILES | CNc1cc(/N=N/c2cc(S(N)(=O)=O)cc([N+](=O)[O-])c2O)ccc1O |
| InChI | InChI=1S/C13H13N5O6S/c1-15-9-4-7(2-3-12(9)19)16-17-10-5-8(25(14,23)24)6-11(13(10)20)18(21)22/h2-6,15,19-20H,1H3,(H2,14,23,24)/b17-16+ |
| InChIKey | IGQDJDOKBQYWHO-WUKNDPDISA-N |
| XLogP | 2.11 |
| TPSA | 180.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|