C8H16O — CID 171391312
1,1,2-trideuteriooct-1-en-3-ol (PubChem CID 171391312) has the molecular formula C8H16O and a molecular weight of 131.23 g/mol. Its IUPAC name is 1,1,2-trideuteriooct-1-en-3-ol.
| Compound Name | 1,1,2-trideuteriooct-1-en-3-ol |
|---|---|
| PubChem CID | 171391312 |
| Molecular Formula | C8H16O |
| Molecular Weight | 131.23 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | 1,1,2-trideuteriooct-1-en-3-ol |
| SMILES | [2H]C([2H])=C([2H])C(O)CCCCC |
| InChI | InChI=1S/C8H16O/c1-3-5-6-7-8(9)4-2/h4,8-9H,2-3,5-7H2,1H3/i2D2,4D |
| InChIKey | VSMOENVRRABVKN-OVLJBECYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|