C19H20N2OS — CID 17139487
2-(2-cyanophenyl)sulfanyl-N-(2,2-dimethylpropyl)benzamide (PubChem CID 17139487) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-(2,2-dimethylpropyl)benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-(2,2-dimethylpropyl)benzamide |
|---|---|
| PubChem CID | 17139487 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-(2,2-dimethylpropyl)benzamide |
| SMILES | CC(C)(C)CNC(=O)c1ccccc1Sc1ccccc1C#N |
| InChI | InChI=1S/C19H20N2OS/c1-19(2,3)13-21-18(22)15-9-5-7-11-17(15)23-16-10-6-4-8-14(16)12-20/h4-11H,13H2,1-3H3,(H,21,22) |
| InChIKey | ZKKLUNBFRFYCAK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |