C22H21N3OS2 — CID 9118288
2-(2-cyanophenyl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide (PubChem CID 9118288) has the molecular formula C22H21N3OS2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 9118288 |
| Molecular Formula | C22H21N3OS2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[(2R)-2-(dimethylamino)-2-thiophen-2-ylethyl]benzamide |
| SMILES | CN(C)[C@H](CNC(=O)c1ccccc1Sc1ccccc1C#N)c1cccs1 |
| InChI | InChI=1S/C22H21N3OS2/c1-25(2)18(21-12-7-13-27-21)15-24-22(26)17-9-4-6-11-20(17)28-19-10-5-3-8-16(19)14-23/h3-13,18H,15H2,1-2H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | VIYKSOAWAXKWGH-GOSISDBHSA-N |
| XLogP | 4.80 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |