C24H29N3OS — CID 55742348
2-(2-cyanophenyl)sulfanyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide (PubChem CID 55742348) has the molecular formula C24H29N3OS and a molecular weight of 407.58 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 55742348 |
| Molecular Formula | C24H29N3OS |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]benzamide |
| SMILES | CC1CC(C)CN(CCCNC(=O)c2ccccc2Sc2ccccc2C#N)C1 |
| InChI | InChI=1S/C24H29N3OS/c1-18-14-19(2)17-27(16-18)13-7-12-26-24(28)21-9-4-6-11-23(21)29-22-10-5-3-8-20(22)15-25/h3-6,8-11,18-19H,7,12-14,16-17H2,1-2H3,(H,26,28) |
| InChIKey | BQGRWERJMDDTAH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|