C23H27N3OS — CID 60576162
2-(2-cyanophenyl)sulfanyl-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]benzamide (PubChem CID 60576162) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is 2-(2-cyanophenyl)sulfanyl-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]benzamide.
| Compound Name | 2-(2-cyanophenyl)sulfanyl-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 60576162 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-(2-cyanophenyl)sulfanyl-N-[1-(3-methylpiperidin-1-yl)propan-2-yl]benzamide |
| SMILES | CC1CCCN(CC(C)NC(=O)c2ccccc2Sc2ccccc2C#N)C1 |
| InChI | InChI=1S/C23H27N3OS/c1-17-8-7-13-26(15-17)16-18(2)25-23(27)20-10-4-6-12-22(20)28-21-11-5-3-9-19(21)14-24/h3-6,9-12,17-18H,7-8,13,15-16H2,1-2H3,(H,25,27) |
| InChIKey | XDOUBBVQLHPLIS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |