C15H32P+ — CID 171395258
tributyl(1,1,2,3,3-pentadeuterioprop-2-enyl)phosphanium (PubChem CID 171395258) has the molecular formula C15H32P+ and a molecular weight of 248.43 g/mol. Its IUPAC name is tributyl(1,1,2,3,3-pentadeuterioprop-2-enyl)phosphanium.
| Compound Name | tributyl(1,1,2,3,3-pentadeuterioprop-2-enyl)phosphanium |
|---|---|
| PubChem CID | 171395258 |
| Molecular Formula | C15H32P+ |
| Molecular Weight | 248.43 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | tributyl(1,1,2,3,3-pentadeuterioprop-2-enyl)phosphanium |
| SMILES | [2H]C([2H])=C([2H])C([2H])([2H])[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C15H32P/c1-5-9-13-16(12-8-4,14-10-6-2)15-11-7-3/h8H,4-7,9-15H2,1-3H3/q+1/i4D2,8D,12D2 |
| InChIKey | FCUPWNWJWSFDMX-QWSOAIBPSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.43 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|