C28H34N2O2 — CID 171395486
N-methyl-4-[[3-(3-phenoxyphenoxy)piperidin-1-yl]methyl]-N-propylaniline (PubChem CID 171395486) has the molecular formula C28H34N2O2 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-methyl-4-[[3-(3-phenoxyphenoxy)piperidin-1-yl]methyl]-N-propylaniline.
| Compound Name | N-methyl-4-[[3-(3-phenoxyphenoxy)piperidin-1-yl]methyl]-N-propylaniline |
|---|---|
| PubChem CID | 171395486 |
| Molecular Formula | C28H34N2O2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-methyl-4-[[3-(3-phenoxyphenoxy)piperidin-1-yl]methyl]-N-propylaniline |
| SMILES | CCCN(C)c1ccc(CN2CCCC(Oc3cccc(Oc4ccccc4)c3)C2)cc1 |
| InChI | InChI=1S/C28H34N2O2/c1-3-18-29(2)24-16-14-23(15-17-24)21-30-19-8-13-28(22-30)32-27-12-7-11-26(20-27)31-25-9-5-4-6-10-25/h4-7,9-12,14-17,20,28H,3,8,13,18-19,21-22H2,1-2H3 |
| InChIKey | AHNKRVIKBJXBLP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|