C16H12BCl2N — CID 171398062
2,2-dichloro-3-azonia-2-boranuidatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaene (PubChem CID 171398062) has the molecular formula C16H12BCl2N and a molecular weight of 300.00 g/mol. Its IUPAC name is 2,2-dichloro-3-azonia-2-boranuidatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaene.
| Compound Name | 2,2-dichloro-3-azonia-2-boranuidatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaene |
|---|---|
| PubChem CID | 171398062 |
| Molecular Formula | C16H12BCl2N |
| Molecular Weight | 300.00 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2,2-dichloro-3-azonia-2-boranuidatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaene |
| SMILES | Cl[B-]1(Cl)c2cc3ccccc3cc2Cc2cccc[n+]21 |
| InChI | InChI=1S/C16H12BCl2N/c18-17(19)16-11-13-6-2-1-5-12(13)9-14(16)10-15-7-3-4-8-20(15)17/h1-9,11H,10H2 |
| InChIKey | ZNZBAFHSIKCSQY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.00 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|