C17H16BN — CID 50916808
17,17-dimethyl-16-azonia-17-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 50916808) has the molecular formula C17H16BN and a molecular weight of 245.13 g/mol. Its IUPAC name is 17,17-dimethyl-16-azonia-17-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | 17,17-dimethyl-16-azonia-17-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 50916808 |
| Molecular Formula | C17H16BN |
| Molecular Weight | 245.13 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 17,17-dimethyl-16-azonia-17-boranuidatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | C[B-]1(C)c2cc3ccccc3cc2-c2cccc[n+]21 |
| InChI | InChI=1S/C17H16BN/c1-18(2)16-12-14-8-4-3-7-13(14)11-15(16)17-9-5-6-10-19(17)18/h3-12H,1-2H3 |
| InChIKey | AJVKEDZRHYJSGA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|