C20H12BrClN2O2S — CID 171398098
(5Z)-5-[(4-bromophenyl)methylidene]-3-[(2-chloroquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 171398098) has the molecular formula C20H12BrClN2O2S and a molecular weight of 459.75 g/mol. Its IUPAC name is (5Z)-5-[(4-bromophenyl)methylidene]-3-[(2-chloroquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-bromophenyl)methylidene]-3-[(2-chloroquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171398098 |
| Molecular Formula | C20H12BrClN2O2S |
| Molecular Weight | 459.75 g/mol |
| Exact Mass | 457.95 |
| IUPAC Name | (5Z)-5-[(4-bromophenyl)methylidene]-3-[(2-chloroquinolin-3-yl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2ccc(Br)cc2)C(=O)N1Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C20H12BrClN2O2S/c21-15-7-5-12(6-8-15)9-17-19(25)24(20(26)27-17)11-14-10-13-3-1-2-4-16(13)23-18(14)22/h1-10H,11H2/b17-9- |
| InChIKey | MHPYSUNFMVPREG-MFOYZWKCSA-N |
| XLogP | 5.89 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|