C21H15ClN2O3S — CID 172640252
(5Z)-3-[(2-chloroquinolin-3-yl)methyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 172640252) has the molecular formula C21H15ClN2O3S and a molecular weight of 410.88 g/mol. Its IUPAC name is (5Z)-3-[(2-chloroquinolin-3-yl)methyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(2-chloroquinolin-3-yl)methyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 172640252 |
| Molecular Formula | C21H15ClN2O3S |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | (5Z)-3-[(2-chloroquinolin-3-yl)methyl]-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2\SC(=O)N(Cc3cc4ccccc4nc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C21H15ClN2O3S/c1-27-16-8-6-13(7-9-16)10-18-20(25)24(21(26)28-18)12-15-11-14-4-2-3-5-17(14)23-19(15)22/h2-11H,12H2,1H3/b18-10- |
| InChIKey | IVCQDUSLYCQMGV-ZDLGFXPLSA-N |
| XLogP | 5.13 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|