C24H38F4N2O4 — CID 171399985
N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-5-fluoro-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 171399985) has the molecular formula C24H38F4N2O4 and a molecular weight of 494.57 g/mol. Its IUPAC name is N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-5-fluoro-6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-5-fluoro-6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171399985 |
| Molecular Formula | C24H38F4N2O4 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | N-[(3S,4R,5R,6R)-4,5-dibutoxy-6-(butoxymethyl)oxan-3-yl]-5-fluoro-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCOC[C@H]1OC[C@H](Nc2ccc(F)c(C(F)(F)F)n2)[C@@H](OCCCC)[C@H]1OCCCC |
| InChI | InChI=1S/C24H38F4N2O4/c1-4-7-12-31-16-19-22(33-14-9-6-3)21(32-13-8-5-2)18(15-34-19)29-20-11-10-17(25)23(30-20)24(26,27)28/h10-11,18-19,21-22H,4-9,12-16H2,1-3H3,(H,29,30)/t18-,19+,21+,22-/m0/s1 |
| InChIKey | FLWNPNZUQYWNAQ-PSBKLILYSA-N |
| XLogP | 5.61 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|