C13H17F4N2O4+ — CID 171400097
(2R,3R,4R,5S)-5-[[5-fluoro-1-methyl-6-(trifluoromethyl)pyridin-1-ium-2-yl]amino]-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 171400097) has the molecular formula C13H17F4N2O4+ and a molecular weight of 341.28 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-[[5-fluoro-1-methyl-6-(trifluoromethyl)pyridin-1-ium-2-yl]amino]-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-5-[[5-fluoro-1-methyl-6-(trifluoromethyl)pyridin-1-ium-2-yl]amino]-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 171400097 |
| Molecular Formula | C13H17F4N2O4+ |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (2R,3R,4R,5S)-5-[[5-fluoro-1-methyl-6-(trifluoromethyl)pyridin-1-ium-2-yl]amino]-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | C[n+]1c(N[C@H]2CO[C@H](CO)[C@H](O)[C@@H]2O)ccc(F)c1C(F)(F)F |
| InChI | InChI=1S/C13H16F4N2O4/c1-19-9(3-2-6(14)12(19)13(15,16)17)18-7-5-23-8(4-20)11(22)10(7)21/h2-3,7-8,10-11,20-22H,4-5H2,1H3/p+1/t7-,8+,10+,11-/m0/s1 |
| InChIKey | JDEZGBQMZXDNGD-URPMGSGRSA-O |
| XLogP | -0.44 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|