C13H24O6 — CID 171403098
1-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-ol (PubChem CID 171403098) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-ol.
| Compound Name | 1-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 171403098 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-[(2,2-dimethyl-1,3-dioxan-5-yl)oxy]-3-[2-(oxiran-2-yl)ethoxy]propan-2-ol |
| SMILES | CC1(C)OCC(OCC(O)COCCC2CO2)CO1 |
| InChI | InChI=1S/C13H24O6/c1-13(2)18-8-12(9-19-13)16-6-10(14)5-15-4-3-11-7-17-11/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | XSTTYXCGGKLZHI-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|