About (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine
(Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine (PubChem CID 171405975) has the molecular formula C17H13N3O2
and a molecular weight of 291.31 g/mol. Its IUPAC name is (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine |
| PubChem CID | 171405975 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine |
| SMILES | C/C(=C(/N)c1ccc(N=C=O)cc1)c1ccc(N=C=O)cc1 |
| InChI | InChI=1S/C17H13N3O2/c1-12(13-2-6-15(7-3-13)19-10-21)17(18)14-4-8-16(9-5-14)20-11-22/h2-9H,18H2,1H3/b17-12- |
| InChIKey | NXYDEFJOPRBGTL-ATVHPVEESA-N |
| XLogP | 3.47 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine?
The IUPAC name of (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine (CID 171405975) is (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine.
What is the SMILES notation for (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine?
The canonical SMILES for (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine is C/C(=C(/N)c1ccc(N=C=O)cc1)c1ccc(N=C=O)cc1.
What is the InChIKey of (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine?
The InChIKey is NXYDEFJOPRBGTL-ATVHPVEESA-N. The full InChI is InChI=1S/C17H13N3O2/c1-12(13-2-6-15(7-3-13)19-10-21)17(18)14-4-8-16(9-5-14)20-11-22/h2-9H,18H2,1H3/b17-12-.
What are the key properties of (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine?
(Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine has a molecular weight of 291.31 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,2-bis(4-isocyanatophenyl)prop-1-en-1-amine is sourced from PubChem (CID 171405975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).