C25H18ClNO2 — CID 171406300
6-chloro-9-ethyl-3,4-diphenylpyrano[2,3-b]indol-2-one (PubChem CID 171406300) has the molecular formula C25H18ClNO2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 6-chloro-9-ethyl-3,4-diphenylpyrano[2,3-b]indol-2-one.
| Compound Name | 6-chloro-9-ethyl-3,4-diphenylpyrano[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 171406300 |
| Molecular Formula | C25H18ClNO2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 6-chloro-9-ethyl-3,4-diphenylpyrano[2,3-b]indol-2-one |
| SMILES | CCn1c2ccc(Cl)cc2c2c(-c3ccccc3)c(-c3ccccc3)c(=O)oc21 |
| InChI | InChI=1S/C25H18ClNO2/c1-2-27-20-14-13-18(26)15-19(20)23-21(16-9-5-3-6-10-16)22(25(28)29-24(23)27)17-11-7-4-8-12-17/h3-15H,2H2,1H3 |
| InChIKey | YPZQFCGDVHZKKM-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |