C24H21N5O2 — CID 171409139
4-amino-1-[(3S)-1-but-2-ynoylpyrrolidin-3-yl]-3-naphthalen-2-yl-6H-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 171409139) has the molecular formula C24H21N5O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-amino-1-[(3S)-1-but-2-ynoylpyrrolidin-3-yl]-3-naphthalen-2-yl-6H-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 4-amino-1-[(3S)-1-but-2-ynoylpyrrolidin-3-yl]-3-naphthalen-2-yl-6H-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 171409139 |
| Molecular Formula | C24H21N5O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-amino-1-[(3S)-1-but-2-ynoylpyrrolidin-3-yl]-3-naphthalen-2-yl-6H-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | CC#CC(=O)N1CC[C@H](n2cc(-c3ccc4ccccc4c3)c3c(N)n[nH]c(=O)c32)C1 |
| InChI | InChI=1S/C24H21N5O2/c1-2-5-20(30)28-11-10-18(13-28)29-14-19(21-22(29)24(31)27-26-23(21)25)17-9-8-15-6-3-4-7-16(15)12-17/h3-4,6-9,12,14,18H,10-11,13H2,1H3,(H2,25,26)(H,27,31)/t18-/m0/s1 |
| InChIKey | LXWOXNBLEJWZEE-SFHVURJKSA-N |
| XLogP | 2.92 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|