C35H39FN6O2 — CID 171412737
8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[[(2S)-1-prop-2-enoylpyrrolidin-2-yl]methylamino]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,6-naphthyridine-3-carbonitrile (PubChem CID 171412737) has the molecular formula C35H39FN6O2 and a molecular weight of 594.74 g/mol. Its IUPAC name is 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[[(2S)-1-prop-2-enoylpyrrolidin-2-yl]methylamino]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,6-naphthyridine-3-carbonitrile.
| Compound Name | 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[[(2S)-1-prop-2-enoylpyrrolidin-2-yl]methylamino]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,6-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171412737 |
| Molecular Formula | C35H39FN6O2 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.31 |
| IUPAC Name | 8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-4-[[(2S)-1-prop-2-enoylpyrrolidin-2-yl]methylamino]-7-(5,6,7,8-tetrahydronaphthalen-1-yl)-1,6-naphthyridine-3-carbonitrile |
| SMILES | C=CC(=O)N1CCC[C@H]1CNc1c(C#N)c(OCC23CCCN2CCC3)nc2c(F)c(-c3cccc4c3CCCC4)ncc12 |
| InChI | InChI=1S/C35H39FN6O2/c1-2-29(43)42-18-6-11-24(42)20-38-31-27(19-37)34(44-22-35-14-7-16-41(35)17-8-15-35)40-33-28(31)21-39-32(30(33)36)26-13-5-10-23-9-3-4-12-25(23)26/h2,5,10,13,21,24H,1,3-4,6-9,11-12,14-18,20,22H2,(H,38,40)/t24-/m0/s1 |
| InChIKey | AQFRPDPQXOPHJR-DEOSSOPVSA-N |
| XLogP | 5.78 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|