C35H17N3S6 — CID 171415490
2-phenyl-5-[7-(5-phenylthieno[2,3-d][1,3]thiazol-2-yl)-[1]benzothiolo[6,5-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 171415490) has the molecular formula C35H17N3S6 and a molecular weight of 671.94 g/mol. Its IUPAC name is 2-phenyl-5-[7-(5-phenylthieno[2,3-d][1,3]thiazol-2-yl)-[1]benzothiolo[6,5-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2-phenyl-5-[7-(5-phenylthieno[2,3-d][1,3]thiazol-2-yl)-[1]benzothiolo[6,5-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 171415490 |
| Molecular Formula | C35H17N3S6 |
| Molecular Weight | 671.94 g/mol |
| Exact Mass | 670.97 |
| IUPAC Name | 2-phenyl-5-[7-(5-phenylthieno[2,3-d][1,3]thiazol-2-yl)-[1]benzothiolo[6,5-f][1]benzothiol-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | c1ccc(-c2cc3sc(-c4cc5cc6cc7sc(-c8nc9sc(-c%10ccccc%10)nc9s8)cc7cc6cc5s4)nc3s2)cc1 |
| InChI | InChI=1S/C35H17N3S6/c1-3-7-18(8-4-1)26-17-29-32(41-26)37-31(42-29)27-15-22-11-20-14-25-23(12-21(20)13-24(22)39-27)16-28(40-25)33-38-35-34(44-33)36-30(43-35)19-9-5-2-6-10-19/h1-17H |
| InChIKey | BTUHGWFOJHOGJI-UHFFFAOYSA-N |
| XLogP | 12.67 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.94 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |