C40H22N2S6 — CID 170274963
2,5-bis[5-(5-phenyl-1-benzothiophen-2-yl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole (PubChem CID 170274963) has the molecular formula C40H22N2S6 and a molecular weight of 723.03 g/mol. Its IUPAC name is 2,5-bis[5-(5-phenyl-1-benzothiophen-2-yl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole.
| Compound Name | 2,5-bis[5-(5-phenyl-1-benzothiophen-2-yl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
|---|---|
| PubChem CID | 170274963 |
| Molecular Formula | C40H22N2S6 |
| Molecular Weight | 723.03 g/mol |
| Exact Mass | 722.01 |
| IUPAC Name | 2,5-bis[5-(5-phenyl-1-benzothiophen-2-yl)thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazole |
| SMILES | c1ccc(-c2ccc3sc(-c4ccc(-c5nc6sc(-c7ccc(-c8cc9cc(-c%10ccccc%10)ccc9s8)s7)nc6s5)s4)cc3c2)cc1 |
| InChI | InChI=1S/C40H22N2S6/c1-3-7-23(8-4-1)25-11-13-29-27(19-25)21-35(43-29)31-15-17-33(45-31)37-41-39-40(47-37)42-38(48-39)34-18-16-32(46-34)36-22-28-20-26(12-14-30(28)44-36)24-9-5-2-6-10-24/h1-22H |
| InChIKey | UKWCSGNWLXYHKR-UHFFFAOYSA-N |
| XLogP | 14.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.03 |
| LogP ≤ 5 | 14.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |