C42H48N4O7 — CID 171418213
[2-[(E)-[methyl(quinoxalin-2-yl)hydrazinylidene]methyl]-4-(4-propylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 171418213) has the molecular formula C42H48N4O7 and a molecular weight of 720.87 g/mol. Its IUPAC name is [2-[(E)-[methyl(quinoxalin-2-yl)hydrazinylidene]methyl]-4-(4-propylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [2-[(E)-[methyl(quinoxalin-2-yl)hydrazinylidene]methyl]-4-(4-propylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 171418213 |
| Molecular Formula | C42H48N4O7 |
| Molecular Weight | 720.87 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | [2-[(E)-[methyl(quinoxalin-2-yl)hydrazinylidene]methyl]-4-(4-propylcyclohexanecarbonyl)oxyphenyl] 4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(OC(=O)C3CCC(CCC)CC3)cc2/C=N/N(C)c2cnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C42H48N4O7/c1-4-12-30-15-17-31(18-16-30)41(48)52-35-23-24-38(33(27-35)28-44-46(3)39-29-43-36-13-8-9-14-37(36)45-39)53-42(49)32-19-21-34(22-20-32)50-25-10-6-7-11-26-51-40(47)5-2/h5,8-9,13-14,19-24,27-31H,2,4,6-7,10-12,15-18,25-26H2,1,3H3/b44-28+ |
| InChIKey | TZWXYZVVHINBGX-HSPICKGMSA-N |
| XLogP | 8.50 |
| TPSA | 129.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.87 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|