C11H22N2 — CID 171423016
(4S)-5-propan-2-yl-1,5-diazaspiro[3.6]decane (PubChem CID 171423016) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is (4S)-5-propan-2-yl-1,5-diazaspiro[3.6]decane.
| Compound Name | (4S)-5-propan-2-yl-1,5-diazaspiro[3.6]decane |
|---|---|
| PubChem CID | 171423016 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | (4S)-5-propan-2-yl-1,5-diazaspiro[3.6]decane |
| SMILES | CC(C)N1CCCCC[C@@]12CCN2 |
| InChI | InChI=1S/C11H22N2/c1-10(2)13-9-5-3-4-6-11(13)7-8-12-11/h10,12H,3-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | PWJSWNHOMPQJJR-NSHDSACASA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |