C21H43N — CID 171424187
1,4-ditert-butyl-4-(2,4,4-trimethylpentyl)piperidine (PubChem CID 171424187) has the molecular formula C21H43N and a molecular weight of 309.58 g/mol. Its IUPAC name is 1,4-ditert-butyl-4-(2,4,4-trimethylpentyl)piperidine.
| Compound Name | 1,4-ditert-butyl-4-(2,4,4-trimethylpentyl)piperidine |
|---|---|
| PubChem CID | 171424187 |
| Molecular Formula | C21H43N |
| Molecular Weight | 309.58 g/mol |
| Exact Mass | 309.34 |
| IUPAC Name | 1,4-ditert-butyl-4-(2,4,4-trimethylpentyl)piperidine |
| SMILES | CC(CC(C)(C)C)CC1(C(C)(C)C)CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H43N/c1-17(15-18(2,3)4)16-21(19(5,6)7)11-13-22(14-12-21)20(8,9)10/h17H,11-16H2,1-10H3 |
| InChIKey | NTJOHHALEQEACQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |