C19H39N — CID 171424047
1,4-ditert-butyl-4-(3,3-dimethylbutyl)piperidine (PubChem CID 171424047) has the molecular formula C19H39N and a molecular weight of 281.53 g/mol. Its IUPAC name is 1,4-ditert-butyl-4-(3,3-dimethylbutyl)piperidine.
| Compound Name | 1,4-ditert-butyl-4-(3,3-dimethylbutyl)piperidine |
|---|---|
| PubChem CID | 171424047 |
| Molecular Formula | C19H39N |
| Molecular Weight | 281.53 g/mol |
| Exact Mass | 281.31 |
| IUPAC Name | 1,4-ditert-butyl-4-(3,3-dimethylbutyl)piperidine |
| SMILES | CC(C)(C)CCC1(C(C)(C)C)CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H39N/c1-16(2,3)10-11-19(17(4,5)6)12-14-20(15-13-19)18(7,8)9/h10-15H2,1-9H3 |
| InChIKey | IUWRFFBRCYRBIU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.53 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |