C16H32N2 — CID 167004629
(2S)-2,8-ditert-butyl-1,8-diazaspiro[4.5]decane (PubChem CID 167004629) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (2S)-2,8-ditert-butyl-1,8-diazaspiro[4.5]decane.
| Compound Name | (2S)-2,8-ditert-butyl-1,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 167004629 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (2S)-2,8-ditert-butyl-1,8-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)[C@@H]1CCC2(CCN(C(C)(C)C)CC2)N1 |
| InChI | InChI=1S/C16H32N2/c1-14(2,3)13-7-8-16(17-13)9-11-18(12-10-16)15(4,5)6/h13,17H,7-12H2,1-6H3/t13-/m0/s1 |
| InChIKey | SBSRZJKWBGSGIA-ZDUSSCGKSA-N |
| XLogP | 3.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |