C20H40N2O — CID 138656844
9-tert-butyl-4-(5,5-dimethylhexyl)-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 138656844) has the molecular formula C20H40N2O and a molecular weight of 324.55 g/mol. Its IUPAC name is 9-tert-butyl-4-(5,5-dimethylhexyl)-1-oxa-4,9-diazaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-4-(5,5-dimethylhexyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 138656844 |
| Molecular Formula | C20H40N2O |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.31 |
| IUPAC Name | 9-tert-butyl-4-(5,5-dimethylhexyl)-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CC(C)(C)CCCCN1CCOC2(CCN(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C20H40N2O/c1-18(2,3)9-7-8-12-21-15-16-23-20(17-21)10-13-22(14-11-20)19(4,5)6/h7-17H2,1-6H3 |
| InChIKey | XGULHHANYDKRQO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|