C19H31NO4 — CID 171426107
1-[(2R)-2-(1-adamantyl)-2-(methylamino)acetyl]oxyethyl 2-methylpropanoate (PubChem CID 171426107) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[(2R)-2-(1-adamantyl)-2-(methylamino)acetyl]oxyethyl 2-methylpropanoate.
| Compound Name | 1-[(2R)-2-(1-adamantyl)-2-(methylamino)acetyl]oxyethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 171426107 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1-[(2R)-2-(1-adamantyl)-2-(methylamino)acetyl]oxyethyl 2-methylpropanoate |
| SMILES | CN[C@@H](C(=O)OC(C)OC(=O)C(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H31NO4/c1-11(2)17(21)23-12(3)24-18(22)16(20-4)19-8-13-5-14(9-19)7-15(6-13)10-19/h11-16,20H,5-10H2,1-4H3/t12?,13?,14?,15?,16-,19?/m0/s1 |
| InChIKey | GBMFEHRGYONVDO-INCKADGYSA-N |
| XLogP | 2.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|