C43H25N3O2 — CID 171430765
2-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine (PubChem CID 171430765) has the molecular formula C43H25N3O2 and a molecular weight of 624.75 g/mol. Its IUPAC name is 2-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine.
| Compound Name | 2-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 171430765 |
| Molecular Formula | C43H25N3O2 |
| Molecular Weight | 624.75 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-(1,2,3,4,5,6,8,9,10-nonadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4-phenyl-6-(4-phenyldibenzofuran-1-yl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)c4oc5ccccc5c34)n2)c2c(oc3c4c([2H])c([2H])c([2H])c([2H])c4c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C43H25N3O2/c1-3-12-26(13-4-1)30-24-25-34(38-31-18-9-10-20-35(31)47-40(30)38)43-45-41(28-15-5-2-6-16-28)44-42(46-43)33-19-11-21-36-37(33)32-23-22-27-14-7-8-17-29(27)39(32)48-36/h1-25H/i7D,8D,11D,14D,17D,19D,21D,22D,23D |
| InChIKey | PYSGTIVIPLLEIY-OBNGVCTNSA-N |
| XLogP | 11.49 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.75 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |