C13H25NS — CID 171431847
2,3-ditert-butyl-4,5,6,7-tetrahydro-1,4-thiazepine (PubChem CID 171431847) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is 2,3-ditert-butyl-4,5,6,7-tetrahydro-1,4-thiazepine.
| Compound Name | 2,3-ditert-butyl-4,5,6,7-tetrahydro-1,4-thiazepine |
|---|---|
| PubChem CID | 171431847 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 2,3-ditert-butyl-4,5,6,7-tetrahydro-1,4-thiazepine |
| SMILES | CC(C)(C)C1=C(C(C)(C)C)SCCCN1 |
| InChI | InChI=1S/C13H25NS/c1-12(2,3)10-11(13(4,5)6)15-9-7-8-14-10/h14H,7-9H2,1-6H3 |
| InChIKey | VCHWPANPYBJTFK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |