C25H22ClN2O+ — CID 171432944
7-chloro-2-[1-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium-5-yl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 171432944) has the molecular formula C25H22ClN2O+ and a molecular weight of 401.92 g/mol. Its IUPAC name is 7-chloro-2-[1-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium-5-yl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-chloro-2-[1-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium-5-yl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 171432944 |
| Molecular Formula | C25H22ClN2O+ |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 7-chloro-2-[1-(1-phenylethyl)pyrrolo[3,2-c]pyridin-5-ium-5-yl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(c1ccccc1)n1ccc2c[n+](C3CCc4ccc(Cl)cc4C3=O)ccc21 |
| InChI | InChI=1S/C25H22ClN2O/c1-17(18-5-3-2-4-6-18)28-14-11-20-16-27(13-12-23(20)28)24-10-8-19-7-9-21(26)15-22(19)25(24)29/h2-7,9,11-17,24H,8,10H2,1H3/q+1 |
| InChIKey | MJOMAFWTSOZCBZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|