C26H24ClN2O+ — CID 176809829
7-chloro-2-[5-(1-phenylpropyl)pyrrolo[3,2-c]pyridin-5-ium-1-yl]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 176809829) has the molecular formula C26H24ClN2O+ and a molecular weight of 415.94 g/mol. Its IUPAC name is 7-chloro-2-[5-(1-phenylpropyl)pyrrolo[3,2-c]pyridin-5-ium-1-yl]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 7-chloro-2-[5-(1-phenylpropyl)pyrrolo[3,2-c]pyridin-5-ium-1-yl]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 176809829 |
| Molecular Formula | C26H24ClN2O+ |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 7-chloro-2-[5-(1-phenylpropyl)pyrrolo[3,2-c]pyridin-5-ium-1-yl]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCC(c1ccccc1)[n+]1ccc2c(ccn2C2CCc3ccc(Cl)cc3C2=O)c1 |
| InChI | InChI=1S/C26H24ClN2O/c1-2-23(19-6-4-3-5-7-19)28-14-13-24-20(17-28)12-15-29(24)25-11-9-18-8-10-21(27)16-22(18)26(25)30/h3-8,10,12-17,23,25H,2,9,11H2,1H3/q+1 |
| InChIKey | BCOCSXIUOUYDJC-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|