C25H14FIrN2- — CID 171436354
15-(4-fluorobenzene-6-id-1-yl)-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene;iridium (PubChem CID 171436354) has the molecular formula C25H14FIrN2- and a molecular weight of 553.62 g/mol. Its IUPAC name is 15-(4-fluorobenzene-6-id-1-yl)-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene;iridium.
| Compound Name | 15-(4-fluorobenzene-6-id-1-yl)-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene;iridium |
|---|---|
| PubChem CID | 171436354 |
| Molecular Formula | C25H14FIrN2- |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 15-(4-fluorobenzene-6-id-1-yl)-14,16-diazapentacyclo[12.6.1.02,7.08,13.017,21]henicosa-1(21),2,4,6,8,10,12,15,17,19-decaene;iridium |
| SMILES | Fc1c[c-]c(-c2nc3cccc4c3n2-c2ccccc2-c2ccccc2-4)cc1.[Ir] |
| InChI | InChI=1S/C25H14FN2.Ir/c26-17-14-12-16(13-15-17)25-27-22-10-5-9-21-19-7-2-1-6-18(19)20-8-3-4-11-23(20)28(25)24(21)22;/h1-12,14-15H;/q-1; |
| InChIKey | ZSOCTODZKHZEGN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|