C16H11F3IrN3- — CID 58426442
3-(1,1-difluoroethyl)-5-(4-fluorobenzene-6-id-1-yl)-4-phenyl-1,2,4-triazole;iridium (PubChem CID 58426442) has the molecular formula C16H11F3IrN3- and a molecular weight of 494.50 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-(4-fluorobenzene-6-id-1-yl)-4-phenyl-1,2,4-triazole;iridium.
| Compound Name | 3-(1,1-difluoroethyl)-5-(4-fluorobenzene-6-id-1-yl)-4-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 58426442 |
| Molecular Formula | C16H11F3IrN3- |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-(4-fluorobenzene-6-id-1-yl)-4-phenyl-1,2,4-triazole;iridium |
| SMILES | CC(F)(F)c1nnc(-c2[c-]cc(F)cc2)n1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C16H11F3N3.Ir/c1-16(18,19)15-21-20-14(11-7-9-12(17)10-8-11)22(15)13-5-3-2-4-6-13;/h2-7,9-10H,1H3;/q-1; |
| InChIKey | QUTYXSKKSHXCMD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|