C40H27N3 — CID 171437987
1,2,3,4,5,6,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-[2,3,4,6-tetradeuterio-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole (PubChem CID 171437987) has the molecular formula C40H27N3 and a molecular weight of 565.77 g/mol. Its IUPAC name is 1,2,3,4,5,6,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-[2,3,4,6-tetradeuterio-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole.
| Compound Name | 1,2,3,4,5,6,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-[2,3,4,6-tetradeuterio-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 171437987 |
| Molecular Formula | C40H27N3 |
| Molecular Weight | 565.77 g/mol |
| Exact Mass | 565.32 |
| IUPAC Name | 1,2,3,4,5,6,8-heptadeuterio-9-(2,3,4,5,6-pentadeuteriophenyl)-7-[2,3,4,6-tetradeuterio-5-(2,6-diphenylpyrimidin-4-yl)phenyl]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c(-c4c([2H])c([2H])c([2H])c(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)c4[2H])c([2H])c32)c([2H])c1[2H] |
| InChI | InChI=1S/C40H27N3/c1-4-13-28(14-5-1)36-27-37(42-40(41-36)29-15-6-2-7-16-29)32-18-12-17-30(25-32)31-23-24-35-34-21-10-11-22-38(34)43(39(35)26-31)33-19-8-3-9-20-33/h1-27H/i3D,8D,9D,10D,11D,12D,17D,18D,19D,20D,21D,22D,23D,24D,25D,26D |
| InChIKey | HASCZZGVIMSYCN-NBQBLRCQSA-N |
| XLogP | 10.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.77 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |