C18H24N2O5S — CID 171439817
1-[4-(4-aminophenyl)sulfonylanilino]-3-(2-hydroxypropoxy)propan-2-ol (PubChem CID 171439817) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)sulfonylanilino]-3-(2-hydroxypropoxy)propan-2-ol.
| Compound Name | 1-[4-(4-aminophenyl)sulfonylanilino]-3-(2-hydroxypropoxy)propan-2-ol |
|---|---|
| PubChem CID | 171439817 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[4-(4-aminophenyl)sulfonylanilino]-3-(2-hydroxypropoxy)propan-2-ol |
| SMILES | CC(O)COCC(O)CNc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-13(21)11-25-12-16(22)10-20-15-4-8-18(9-5-15)26(23,24)17-6-2-14(19)3-7-17/h2-9,13,16,20-22H,10-12,19H2,1H3 |
| InChIKey | NEUDBZBSCGNSSG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|